About 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine
3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine (PubChem CID 130178535) has the molecular formula C19H21N5
and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine.
Molecular Properties
| Compound Name | 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine |
| PubChem CID | 130178535 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine |
| SMILES | Cc1cc(Cc2nc(Cc3cncnc3C)cnc2C)cnc1C |
| InChI | InChI=1S/C19H21N5/c1-12-5-16(8-21-13(12)2)6-19-15(4)22-10-18(24-19)7-17-9-20-11-23-14(17)3/h5,8-11H,6-7H2,1-4H3 |
| InChIKey | UQGKFFBMNDEWBG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine?
The IUPAC name of 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine (CID 130178535) is 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine.
What is the SMILES notation for 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine?
The canonical SMILES for 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine is Cc1cc(Cc2nc(Cc3cncnc3C)cnc2C)cnc1C.
What is the InChIKey of 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine?
The InChIKey is UQGKFFBMNDEWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5/c1-12-5-16(8-21-13(12)2)6-19-15(4)22-10-18(24-19)7-17-9-20-11-23-14(17)3/h5,8-11H,6-7H2,1-4H3.
What are the key properties of 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine?
3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine has a molecular weight of 319.41 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,6-dimethyl-3-pyridinyl)methyl]-2-methyl-5-[(4-methylpyrimidin-5-yl)methyl]pyrazine is sourced from PubChem (CID 130178535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).