About (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide
(3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 130178588) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide.
Molecular Properties
| Compound Name | (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide |
| PubChem CID | 130178588 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=C(C)[C@H](C)CC=C1 |
| InChI | InChI=1S/C9H14N2/c1-6-4-3-5-8(7(6)2)9(10)11/h3,5-6H,4H2,1-2H3,(H3,10,11)/t6-/m1/s1 |
| InChIKey | BFJPFUYPCFDWBC-ZCFIWIBFSA-N |
| XLogP | 1.83 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide?
The IUPAC name of (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide (CID 130178588) is (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide.
What is the SMILES notation for (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide?
The canonical SMILES for (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide is [H]/N=C(\N)C1=C(C)[C@H](C)CC=C1.
What is the InChIKey of (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide?
The InChIKey is BFJPFUYPCFDWBC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H14N2/c1-6-4-3-5-8(7(6)2)9(10)11/h3,5-6H,4H2,1-2H3,(H3,10,11)/t6-/m1/s1.
What are the key properties of (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide?
(3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide has a molecular weight of 150.22 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dimethylcyclohexa-1,5-diene-1-carboximidamide is sourced from PubChem (CID 130178588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).