C19H32O — CID 130178622
2-(2-ethyl-2-methylbutyl)-6-(3-methylpentan-3-yl)phenol (PubChem CID 130178622) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 2-(2-ethyl-2-methylbutyl)-6-(3-methylpentan-3-yl)phenol.
| Compound Name | 2-(2-ethyl-2-methylbutyl)-6-(3-methylpentan-3-yl)phenol |
|---|---|
| PubChem CID | 130178622 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 2-(2-ethyl-2-methylbutyl)-6-(3-methylpentan-3-yl)phenol |
| SMILES | CCC(C)(CC)Cc1cccc(C(C)(CC)CC)c1O |
| InChI | InChI=1S/C19H32O/c1-7-18(5,8-2)14-15-12-11-13-16(17(15)20)19(6,9-3)10-4/h11-13,20H,7-10,14H2,1-6H3 |
| InChIKey | SDHXANUERALTPZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |