C27H23NO4 — CID 130178917
(2E,3Z)-3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]-2-ethylidenehexa-3,5-dienoic acid (PubChem CID 130178917) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is (2E,3Z)-3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]-2-ethylidenehexa-3,5-dienoic acid.
| Compound Name | (2E,3Z)-3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]-2-ethylidenehexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 130178917 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2E,3Z)-3-[10-(dimethylamino)-3-oxobenzo[c]xanthen-7-yl]-2-ethylidenehexa-3,5-dienoic acid |
| SMILES | C=C/C=C(C(=C/C)\C(=O)O)/c1c2ccc(N(C)C)cc2oc2c1ccc1cc(=O)ccc12 |
| InChI | InChI=1S/C27H23NO4/c1-5-7-21(19(6-2)27(30)31)25-22-12-9-17(28(3)4)15-24(22)32-26-20-13-10-18(29)14-16(20)8-11-23(25)26/h5-15H,1H2,2-4H3,(H,30,31)/b19-6+,21-7+ |
| InChIKey | XIWVGJSSSWLQRY-RYZOKDPBSA-N |
| XLogP | 5.77 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|