C28H42O9 — CID 130179021
1-[(1S,4S,5R,7S,8S,9R,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]butan-2-one (PubChem CID 130179021) has the molecular formula C28H42O9 and a molecular weight of 522.64 g/mol. Its IUPAC name is 1-[(1S,4S,5R,7S,8S,9R,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]butan-2-one.
| Compound Name | 1-[(1S,4S,5R,7S,8S,9R,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 130179021 |
| Molecular Formula | C28H42O9 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 1-[(1S,4S,5R,7S,8S,9R,11R)-4,8-dihydroxy-11-[2-oxo-3-[(3S)-oxolan-3-yl]propyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-5-yl]-4-[(2S,5S)-5-ethyl-4-methylideneoxolan-2-yl]butan-2-one |
| SMILES | C=C1C[C@H](CCC(=O)C[C@H]2O[C@@H]3C(O[C@H]4CC[C@H](CC(=O)C[C@@H]5CCOC5)O[C@@H]4[C@@H]3O)[C@H]2O)O[C@H]1CC |
| InChI | InChI=1S/C28H42O9/c1-3-21-15(2)10-19(34-21)5-4-17(29)13-23-24(31)27-28(37-23)25(32)26-22(36-27)7-6-20(35-26)12-18(30)11-16-8-9-33-14-16/h16,19-28,31-32H,2-14H2,1H3/t16-,19-,20+,21-,22-,23+,24-,25-,26-,27?,28-/m0/s1 |
| InChIKey | AHCSJQOSWQSZCB-JPDSRITDSA-N |
| XLogP | 2.04 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|