C12H22N2 — CID 130179315
(1Z,4Z)-N,N-dimethyl-3-methylimino-2-propan-2-ylhexa-1,4-dien-1-amine (PubChem CID 130179315) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (1Z,4Z)-N,N-dimethyl-3-methylimino-2-propan-2-ylhexa-1,4-dien-1-amine.
| Compound Name | (1Z,4Z)-N,N-dimethyl-3-methylimino-2-propan-2-ylhexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 130179315 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (1Z,4Z)-N,N-dimethyl-3-methylimino-2-propan-2-ylhexa-1,4-dien-1-amine |
| SMILES | C/C=C\C(=N/C)\C(=C/N(C)C)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-7-8-12(13-4)11(10(2)3)9-14(5)6/h7-10H,1-6H3/b8-7-,11-9-,13-12+ |
| InChIKey | YQAPQWKKFQVILJ-BKDJHKDISA-N |
| XLogP | 2.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|