C21H23ClN4O3 — CID 130179943
N-[[4-(4-chlorobenzoyl)morpholin-3-yl]methyl]-4-(N'-methylcarbamimidoyl)benzamide (PubChem CID 130179943) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-[[4-(4-chlorobenzoyl)morpholin-3-yl]methyl]-4-(N'-methylcarbamimidoyl)benzamide.
| Compound Name | N-[[4-(4-chlorobenzoyl)morpholin-3-yl]methyl]-4-(N'-methylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 130179943 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[[4-(4-chlorobenzoyl)morpholin-3-yl]methyl]-4-(N'-methylcarbamimidoyl)benzamide |
| SMILES | C/N=C(\N)c1ccc(C(=O)NCC2COCCN2C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-24-19(23)14-2-4-15(5-3-14)20(27)25-12-18-13-29-11-10-26(18)21(28)16-6-8-17(22)9-7-16/h2-9,18H,10-13H2,1H3,(H2,23,24)(H,25,27) |
| InChIKey | ZKWKZXYSVDZBGY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|