C18H21BrO2 — CID 130180423
(2S,6R)-4-(5-bromo-2-ethylphenyl)tricyclo[5.2.1.02,6]dec-3-ene-3,5-diol (PubChem CID 130180423) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is (2S,6R)-4-(5-bromo-2-ethylphenyl)tricyclo[5.2.1.02,6]dec-3-ene-3,5-diol.
| Compound Name | (2S,6R)-4-(5-bromo-2-ethylphenyl)tricyclo[5.2.1.02,6]dec-3-ene-3,5-diol |
|---|---|
| PubChem CID | 130180423 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2S,6R)-4-(5-bromo-2-ethylphenyl)tricyclo[5.2.1.02,6]dec-3-ene-3,5-diol |
| SMILES | CCc1ccc(Br)cc1C1=C(O)[C@H]2C3CCC(C3)[C@H]2C1O |
| InChI | InChI=1S/C18H21BrO2/c1-2-9-5-6-12(19)8-13(9)16-17(20)14-10-3-4-11(7-10)15(14)18(16)21/h5-6,8,10-11,14-15,17,20-21H,2-4,7H2,1H3/t10?,11?,14-,15+,17?/m1/s1 |
| InChIKey | KKUXCFGHQLFTKO-UWTPAYGJSA-N |
| XLogP | 4.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |