About (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine
(E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine (PubChem CID 130180649) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine |
| PubChem CID | 130180649 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine |
| SMILES | C/C=C\C(=C/CC)C(N)N |
| InChI | InChI=1S/C8H16N2/c1-3-5-7(6-4-2)8(9)10/h3,5-6,8H,4,9-10H2,1-2H3/b5-3-,7-6+ |
| InChIKey | BFUJXTBNVUSXBG-AIJKMKQJSA-N |
| XLogP | 1.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine?
The IUPAC name of (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine (CID 130180649) is (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine.
What is the SMILES notation for (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine?
The canonical SMILES for (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine is C/C=C\C(=C/CC)C(N)N.
What is the InChIKey of (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine?
The InChIKey is BFUJXTBNVUSXBG-AIJKMKQJSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-5-7(6-4-2)8(9)10/h3,5-6,8H,4,9-10H2,1-2H3/b5-3-,7-6+.
What are the key properties of (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine?
(E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine has a molecular weight of 140.23 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[(Z)-prop-1-enyl]pent-2-ene-1,1-diamine is sourced from PubChem (CID 130180649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).