C43H40N4 — CID 130180832
6-[3-(1,4,4a,8a-tetrahydronaphthalen-1-yl)-5-[4-(6-methyl-2,3-dihydropyridin-3-yl)phenyl]phenyl]-2,4-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 130180832) has the molecular formula C43H40N4 and a molecular weight of 612.82 g/mol. Its IUPAC name is 6-[3-(1,4,4a,8a-tetrahydronaphthalen-1-yl)-5-[4-(6-methyl-2,3-dihydropyridin-3-yl)phenyl]phenyl]-2,4-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 6-[3-(1,4,4a,8a-tetrahydronaphthalen-1-yl)-5-[4-(6-methyl-2,3-dihydropyridin-3-yl)phenyl]phenyl]-2,4-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 130180832 |
| Molecular Formula | C43H40N4 |
| Molecular Weight | 612.82 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | 6-[3-(1,4,4a,8a-tetrahydronaphthalen-1-yl)-5-[4-(6-methyl-2,3-dihydropyridin-3-yl)phenyl]phenyl]-2,4-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | CC1=NCC(c2ccc(-c3cc(C4=NC(c5ccccc5)NC(c5ccccc5)N4)cc(C4C=CCC5C=CC=CC54)c3)cc2)C=C1 |
| InChI | InChI=1S/C43H40N4/c1-29-19-20-35(28-44-29)30-21-23-31(24-22-30)36-25-37(40-18-10-16-32-11-8-9-17-39(32)40)27-38(26-36)43-46-41(33-12-4-2-5-13-33)45-42(47-43)34-14-6-3-7-15-34/h2-15,17-27,32,35,39-42,45H,16,28H2,1H3,(H,46,47) |
| InChIKey | ALEJVGGFQCBBFP-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.82 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|