About 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol
2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol (PubChem CID 130180863) has the molecular formula C18H17Cl2NO3
and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol.
Molecular Properties
| Compound Name | 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol |
| PubChem CID | 130180863 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol |
| SMILES | CCc1ccc(Oc2ncc(Cl)cc2Cl)cc1C1=C(O)CCC1O |
| InChI | InChI=1S/C18H17Cl2NO3/c1-2-10-3-4-12(24-18-14(20)7-11(19)9-21-18)8-13(10)17-15(22)5-6-16(17)23/h3-4,7-9,15,22-23H,2,5-6H2,1H3 |
| InChIKey | BYFHFWRRWYXOSH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol?
The IUPAC name of 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol (CID 130180863) is 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol.
What is the SMILES notation for 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol?
The canonical SMILES for 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol is CCc1ccc(Oc2ncc(Cl)cc2Cl)cc1C1=C(O)CCC1O.
What is the InChIKey of 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol?
The InChIKey is BYFHFWRRWYXOSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO3/c1-2-10-3-4-12(24-18-14(20)7-11(19)9-21-18)8-13(10)17-15(22)5-6-16(17)23/h3-4,7-9,15,22-23H,2,5-6H2,1H3.
What are the key properties of 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol?
2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol has a molecular weight of 366.24 g/mol, XLogP of 5.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]cyclopentene-1,3-diol is sourced from PubChem (CID 130180863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).