C19H28ClN3O2 — CID 130181039
5-chloro-1,3,3,5-tetramethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)pyrazolidine-4-carboxamide (PubChem CID 130181039) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is 5-chloro-1,3,3,5-tetramethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)pyrazolidine-4-carboxamide.
| Compound Name | 5-chloro-1,3,3,5-tetramethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)pyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 130181039 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 5-chloro-1,3,3,5-tetramethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)pyrazolidine-4-carboxamide |
| SMILES | CC1OC(C)(C)c2cccc(NC(=O)C3C(C)(C)NN(C)C3(C)Cl)c21 |
| InChI | InChI=1S/C19H28ClN3O2/c1-11-14-12(18(4,5)25-11)9-8-10-13(14)21-16(24)15-17(2,3)22-23(7)19(15,6)20/h8-11,15,22H,1-7H3,(H,21,24) |
| InChIKey | ARHVKNIFJPFNHN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|