C11H20N2 — CID 130181126
(4E)-N,4,6-trimethyl-5-(methylideneamino)hepta-4,6-dien-1-amine (PubChem CID 130181126) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (4E)-N,4,6-trimethyl-5-(methylideneamino)hepta-4,6-dien-1-amine.
| Compound Name | (4E)-N,4,6-trimethyl-5-(methylideneamino)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 130181126 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (4E)-N,4,6-trimethyl-5-(methylideneamino)hepta-4,6-dien-1-amine |
| SMILES | C=N/C(C(=C)C)=C(\C)CCCNC |
| InChI | InChI=1S/C11H20N2/c1-9(2)11(13-5)10(3)7-6-8-12-4/h12H,1,5-8H2,2-4H3/b11-10+ |
| InChIKey | FZQLPIIMFPKTIG-ZHACJKMWSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|