C16H24O3 — CID 130181446
3-[(3E,5Z)-4-methoxy-3,5-dimethyl-2-methylidenehepta-3,5-dienyl]pentane-2,4-dione (PubChem CID 130181446) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 3-[(3E,5Z)-4-methoxy-3,5-dimethyl-2-methylidenehepta-3,5-dienyl]pentane-2,4-dione.
| Compound Name | 3-[(3E,5Z)-4-methoxy-3,5-dimethyl-2-methylidenehepta-3,5-dienyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 130181446 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-[(3E,5Z)-4-methoxy-3,5-dimethyl-2-methylidenehepta-3,5-dienyl]pentane-2,4-dione |
| SMILES | C=C(CC(C(C)=O)C(C)=O)/C(C)=C(OC)\C(C)=C/C |
| InChI | InChI=1S/C16H24O3/c1-8-10(2)16(19-7)12(4)11(3)9-15(13(5)17)14(6)18/h8,15H,3,9H2,1-2,4-7H3/b10-8-,16-12+ |
| InChIKey | SAQJFBGMGOROPY-XXNDDHLVSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|