About benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate
benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate (PubChem CID 13018171) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate |
| PubChem CID | 13018171 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate |
| SMILES | C[C@H](O)[C@H]1C(=O)N[C@@H]1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-9(16)13-11(15-14(13)18)7-12(17)19-8-10-5-3-2-4-6-10/h2-6,9,11,13,16H,7-8H2,1H3,(H,15,18)/t9-,11+,13+/m0/s1 |
| InChIKey | VEOGAZMGGUEDBF-UFGOTCBOSA-N |
| XLogP | 0.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate?
The IUPAC name of benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate (CID 13018171) is benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate.
What is the SMILES notation for benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate?
The canonical SMILES for benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate is C[C@H](O)[C@H]1C(=O)N[C@@H]1CC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate?
The InChIKey is VEOGAZMGGUEDBF-UFGOTCBOSA-N. The full InChI is InChI=1S/C14H17NO4/c1-9(16)13-11(15-14(13)18)7-12(17)19-8-10-5-3-2-4-6-10/h2-6,9,11,13,16H,7-8H2,1H3,(H,15,18)/t9-,11+,13+/m0/s1.
What are the key properties of benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate?
benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate has a molecular weight of 263.29 g/mol, XLogP of 0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(2R,3S)-3-[(1S)-1-hydroxyethyl]-4-oxoazetidin-2-yl]acetate is sourced from PubChem (CID 13018171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).