C25H29N5O4 — CID 130182079
3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1,2,3a,9a-tetrahydrobenzo[f]benzotriazole-4,9-dione (PubChem CID 130182079) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1,2,3a,9a-tetrahydrobenzo[f]benzotriazole-4,9-dione.
| Compound Name | 3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1,2,3a,9a-tetrahydrobenzo[f]benzotriazole-4,9-dione |
|---|---|
| PubChem CID | 130182079 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-[3-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]propyl]-1,2,3a,9a-tetrahydrobenzo[f]benzotriazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)C2C1NNN2CCCN1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C25H29N5O4/c31-24-18-4-1-2-5-19(18)25(32)23-22(24)26-27-30(23)9-3-8-28-10-12-29(13-11-28)17-6-7-20-21(16-17)34-15-14-33-20/h1-2,4-7,16,22-23,26-27H,3,8-15H2 |
| InChIKey | ITFUXUYBKPBFNX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|