C10H17N — CID 130182236
(8R)-8-methyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline (PubChem CID 130182236) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (8R)-8-methyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline.
| Compound Name | (8R)-8-methyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline |
|---|---|
| PubChem CID | 130182236 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (8R)-8-methyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline |
| SMILES | C[C@@H]1CCCC2CCNC=C21 |
| InChI | InChI=1S/C10H17N/c1-8-3-2-4-9-5-6-11-7-10(8)9/h7-9,11H,2-6H2,1H3/t8-,9?/m1/s1 |
| InChIKey | PPCCDFLTTRFNES-VEDVMXKPSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |