About 4,8-dimethylfuro[2,3-f][1]benzofuran
4,8-dimethylfuro[2,3-f][1]benzofuran (PubChem CID 130182469) has the molecular formula C12H10O2
and a molecular weight of 186.21 g/mol. Its IUPAC name is 4,8-dimethylfuro[2,3-f][1]benzofuran.
Molecular Properties
| Compound Name | 4,8-dimethylfuro[2,3-f][1]benzofuran |
| PubChem CID | 130182469 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4,8-dimethylfuro[2,3-f][1]benzofuran |
| SMILES | Cc1c2ccoc2c(C)c2ccoc12 |
| InChI | InChI=1S/C12H10O2/c1-7-9-3-5-14-12(9)8(2)10-4-6-13-11(7)10/h3-6H,1-2H3 |
| InChIKey | BXQBHLBAHVTYAZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8-dimethylfuro[2,3-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethylfuro[2,3-f][1]benzofuran?
The IUPAC name of 4,8-dimethylfuro[2,3-f][1]benzofuran (CID 130182469) is 4,8-dimethylfuro[2,3-f][1]benzofuran.
What is the SMILES notation for 4,8-dimethylfuro[2,3-f][1]benzofuran?
The canonical SMILES for 4,8-dimethylfuro[2,3-f][1]benzofuran is Cc1c2ccoc2c(C)c2ccoc12.
What is the InChIKey of 4,8-dimethylfuro[2,3-f][1]benzofuran?
The InChIKey is BXQBHLBAHVTYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2/c1-7-9-3-5-14-12(9)8(2)10-4-6-13-11(7)10/h3-6H,1-2H3.
What are the key properties of 4,8-dimethylfuro[2,3-f][1]benzofuran?
4,8-dimethylfuro[2,3-f][1]benzofuran has a molecular weight of 186.21 g/mol, XLogP of 3.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethylfuro[2,3-f][1]benzofuran is sourced from PubChem (CID 130182469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).