About (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal
(2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal (PubChem CID 130182534) has the molecular formula C9H6BrF3O2
and a molecular weight of 283.04 g/mol. Its IUPAC name is (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal.
Molecular Properties
| Compound Name | (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal |
| PubChem CID | 130182534 |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.04 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal |
| SMILES | O=C/C(=C/c1ccc(Br)o1)CC(F)(F)F |
| InChI | InChI=1S/C9H6BrF3O2/c10-8-2-1-7(15-8)3-6(5-14)4-9(11,12)13/h1-3,5H,4H2/b6-3+ |
| InChIKey | INRIJLMMJGMYDV-ZZXKWVIFSA-N |
| XLogP | 3.58 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal?
The IUPAC name of (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal (CID 130182534) is (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal.
What is the SMILES notation for (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal?
The canonical SMILES for (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal is O=C/C(=C/c1ccc(Br)o1)CC(F)(F)F.
What is the InChIKey of (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal?
The InChIKey is INRIJLMMJGMYDV-ZZXKWVIFSA-N. The full InChI is InChI=1S/C9H6BrF3O2/c10-8-2-1-7(15-8)3-6(5-14)4-9(11,12)13/h1-3,5H,4H2/b6-3+.
What are the key properties of (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal?
(2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal has a molecular weight of 283.04 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(5-bromofuran-2-yl)methylidene]-4,4,4-trifluorobutanal is sourced from PubChem (CID 130182534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).