C27H36N2 — CID 130182871
N-[2-butyl-4-(1-cyclohexa-1,3-dien-1-ylethenyl)-1-[(3E,5E)-3,6-dimethylocta-1,3,5,7-tetraen-2-yl]-2,5-dihydropyrrol-3-yl]methanimine (PubChem CID 130182871) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is N-[2-butyl-4-(1-cyclohexa-1,3-dien-1-ylethenyl)-1-[(3E,5E)-3,6-dimethylocta-1,3,5,7-tetraen-2-yl]-2,5-dihydropyrrol-3-yl]methanimine.
| Compound Name | N-[2-butyl-4-(1-cyclohexa-1,3-dien-1-ylethenyl)-1-[(3E,5E)-3,6-dimethylocta-1,3,5,7-tetraen-2-yl]-2,5-dihydropyrrol-3-yl]methanimine |
|---|---|
| PubChem CID | 130182871 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N-[2-butyl-4-(1-cyclohexa-1,3-dien-1-ylethenyl)-1-[(3E,5E)-3,6-dimethylocta-1,3,5,7-tetraen-2-yl]-2,5-dihydropyrrol-3-yl]methanimine |
| SMILES | C=C/C(C)=C/C=C(\C)C(=C)N1CC(C(=C)C2=CC=CCC2)=C(N=C)C1CCCC |
| InChI | InChI=1S/C27H36N2/c1-8-10-16-26-27(28-7)25(22(5)24-14-12-11-13-15-24)19-29(26)23(6)21(4)18-17-20(3)9-2/h9,11-12,14,17-18,26H,2,5-8,10,13,15-16,19H2,1,3-4H3/b20-17+,21-18+ |
| InChIKey | KONWODWSIPABSV-PHEFWILJSA-N |
| XLogP | 7.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|