C30H43FN2 — CID 130182897
(2Z,4Z,6Z)-3-(1-fluoroethenyl)-N-[(Z)-4-(4-methylphenyl)-4-(nonan-4-ylideneamino)but-3-enyl]octa-2,4,6-trien-1-amine (PubChem CID 130182897) has the molecular formula C30H43FN2 and a molecular weight of 450.69 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3-(1-fluoroethenyl)-N-[(Z)-4-(4-methylphenyl)-4-(nonan-4-ylideneamino)but-3-enyl]octa-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z,6Z)-3-(1-fluoroethenyl)-N-[(Z)-4-(4-methylphenyl)-4-(nonan-4-ylideneamino)but-3-enyl]octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 130182897 |
| Molecular Formula | C30H43FN2 |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | (2Z,4Z,6Z)-3-(1-fluoroethenyl)-N-[(Z)-4-(4-methylphenyl)-4-(nonan-4-ylideneamino)but-3-enyl]octa-2,4,6-trien-1-amine |
| SMILES | C=C(F)C(/C=C\C=C/C)=C\CNCC/C=C(\N=C(/CCC)CCCCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H43FN2/c1-6-9-11-15-27(26(5)31)22-24-32-23-13-17-30(28-20-18-25(4)19-21-28)33-29(14-8-3)16-12-10-7-2/h6,9,11,15,17-22,32H,5,7-8,10,12-14,16,23-24H2,1-4H3/b9-6-,15-11-,27-22-,30-17-,33-29+ |
| InChIKey | XDJJSCQGCVTEGF-OTFXMMJPSA-N |
| XLogP | 8.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|