C29H45N3 — CID 130183055
(2Z,4Z,7Z)-1-N-(2,2-dimethylpropyl)-9-N-ethyl-3-methyl-6-methylidene-7-(methylideneamino)-9-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]deca-2,4,7,9-tetraene-1,9-diamine (PubChem CID 130183055) has the molecular formula C29H45N3 and a molecular weight of 435.70 g/mol. Its IUPAC name is (2Z,4Z,7Z)-1-N-(2,2-dimethylpropyl)-9-N-ethyl-3-methyl-6-methylidene-7-(methylideneamino)-9-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]deca-2,4,7,9-tetraene-1,9-diamine.
| Compound Name | (2Z,4Z,7Z)-1-N-(2,2-dimethylpropyl)-9-N-ethyl-3-methyl-6-methylidene-7-(methylideneamino)-9-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]deca-2,4,7,9-tetraene-1,9-diamine |
|---|---|
| PubChem CID | 130183055 |
| Molecular Formula | C29H45N3 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.36 |
| IUPAC Name | (2Z,4Z,7Z)-1-N-(2,2-dimethylpropyl)-9-N-ethyl-3-methyl-6-methylidene-7-(methylideneamino)-9-N-[(2E,3Z)-2-propylidenehexa-3,5-dienyl]deca-2,4,7,9-tetraene-1,9-diamine |
| SMILES | C=C/C=C\C(=C/CC)CN(CC)C(=C)/C=C(\N=C)C(=C)/C=C\C(C)=C/CNCC(C)(C)C |
| InChI | InChI=1S/C29H45N3/c1-11-14-16-27(15-12-2)22-32(13-3)26(6)21-28(30-10)25(5)18-17-24(4)19-20-31-23-29(7,8)9/h11,14-19,21,31H,1,5-6,10,12-13,20,22-23H2,2-4,7-9H3/b16-14-,18-17-,24-19-,27-15+,28-21- |
| InChIKey | XLHPKXTVTOOOCV-FRVDFEJLSA-N |
| XLogP | 7.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|