C16H27N — CID 130183099
(2E,4E)-N,N-diethyl-3,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-1-amine (PubChem CID 130183099) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (2E,4E)-N,N-diethyl-3,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4E)-N,N-diethyl-3,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 130183099 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (2E,4E)-N,N-diethyl-3,5-dimethyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C(C)=C(\C=C/C)C(/C)=C/CN(CC)CC |
| InChI | InChI=1S/C16H27N/c1-7-11-16(14(5)8-2)15(6)12-13-17(9-3)10-4/h7-8,11-12H,2,9-10,13H2,1,3-6H3/b11-7-,15-12+,16-14+ |
| InChIKey | MYHCXVZCDSWQGL-UTOQGEBTSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|