C24H34F3N3 — CID 130183101
N'-[(Z)-3-cyclohexa-1,5-dien-1-yl-3-(methylideneamino)prop-2-enyl]-N-[(3E)-2-methylidenehexa-3,5-dienyl]-N'-(5,5,5-trifluoropentyl)ethane-1,2-diamine (PubChem CID 130183101) has the molecular formula C24H34F3N3 and a molecular weight of 421.55 g/mol. Its IUPAC name is N'-[(Z)-3-cyclohexa-1,5-dien-1-yl-3-(methylideneamino)prop-2-enyl]-N-[(3E)-2-methylidenehexa-3,5-dienyl]-N'-(5,5,5-trifluoropentyl)ethane-1,2-diamine.
| Compound Name | N'-[(Z)-3-cyclohexa-1,5-dien-1-yl-3-(methylideneamino)prop-2-enyl]-N-[(3E)-2-methylidenehexa-3,5-dienyl]-N'-(5,5,5-trifluoropentyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130183101 |
| Molecular Formula | C24H34F3N3 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N'-[(Z)-3-cyclohexa-1,5-dien-1-yl-3-(methylideneamino)prop-2-enyl]-N-[(3E)-2-methylidenehexa-3,5-dienyl]-N'-(5,5,5-trifluoropentyl)ethane-1,2-diamine |
| SMILES | C=C/C=C/C(=C)CNCCN(C/C=C(\N=C)C1=CCCC=C1)CCCCC(F)(F)F |
| InChI | InChI=1S/C24H34F3N3/c1-4-5-11-21(2)20-29-16-19-30(17-10-9-15-24(25,26)27)18-14-23(28-3)22-12-7-6-8-13-22/h4-5,7,11-14,29H,1-3,6,8-10,15-20H2/b11-5+,23-14- |
| InChIKey | ASTGMNFMZNWPOX-QQVMNHQFSA-N |
| XLogP | 5.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|