C25H21N3O2 — CID 130183151
(2Z,4E)-5-[5-[5-[5-[(1E,3Z)-4-cyanopenta-1,3-dienyl]furan-2-yl]-1-methylpyrrol-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile (PubChem CID 130183151) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2Z,4E)-5-[5-[5-[5-[(1E,3Z)-4-cyanopenta-1,3-dienyl]furan-2-yl]-1-methylpyrrol-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-[5-[5-[5-[(1E,3Z)-4-cyanopenta-1,3-dienyl]furan-2-yl]-1-methylpyrrol-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 130183151 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2Z,4E)-5-[5-[5-[5-[(1E,3Z)-4-cyanopenta-1,3-dienyl]furan-2-yl]-1-methylpyrrol-2-yl]furan-2-yl]-2-methylpenta-2,4-dienenitrile |
| SMILES | C/C(C#N)=C/C=C/c1ccc(-c2ccc(-c3ccc(/C=C/C=C(/C)C#N)o3)n2C)o1 |
| InChI | InChI=1S/C25H21N3O2/c1-18(16-26)6-4-8-20-10-14-24(29-20)22-12-13-23(28(22)3)25-15-11-21(30-25)9-5-7-19(2)17-27/h4-15H,1-3H3/b8-4+,9-5+,18-6-,19-7- |
| InChIKey | GNIFKWUKKYKELT-VSSHSNHWSA-N |
| XLogP | 6.51 |
| TPSA | 78.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|