C28H43N3 — CID 130183252
8-butyl-6-(4-ethylhept-1-en-2-yl)-2-(4-methylcyclohexa-1,3-dien-1-yl)-4-methylidene-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 130183252) has the molecular formula C28H43N3 and a molecular weight of 421.67 g/mol. Its IUPAC name is 8-butyl-6-(4-ethylhept-1-en-2-yl)-2-(4-methylcyclohexa-1,3-dien-1-yl)-4-methylidene-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 8-butyl-6-(4-ethylhept-1-en-2-yl)-2-(4-methylcyclohexa-1,3-dien-1-yl)-4-methylidene-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 130183252 |
| Molecular Formula | C28H43N3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.35 |
| IUPAC Name | 8-butyl-6-(4-ethylhept-1-en-2-yl)-2-(4-methylcyclohexa-1,3-dien-1-yl)-4-methylidene-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | C=C1NC(C2=CC=C(C)CC2)=NC2=C1CN(C(=C)CC(CC)CCC)CC2CCCC |
| InChI | InChI=1S/C28H43N3/c1-7-10-12-25-18-31(21(5)17-23(9-3)11-8-2)19-26-22(6)29-28(30-27(25)26)24-15-13-20(4)14-16-24/h13,15,23,25H,5-12,14,16-19H2,1-4H3,(H,29,30) |
| InChIKey | IJJWSPGLKSRILQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |