C20H24O2 — CID 130183284
2-cyclohexa-1,5-dien-1-yl-8-(3-methylbut-3-enyl)-5,6,7,8-tetrahydrochromen-4-one (PubChem CID 130183284) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-8-(3-methylbut-3-enyl)-5,6,7,8-tetrahydrochromen-4-one.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-8-(3-methylbut-3-enyl)-5,6,7,8-tetrahydrochromen-4-one |
|---|---|
| PubChem CID | 130183284 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-8-(3-methylbut-3-enyl)-5,6,7,8-tetrahydrochromen-4-one |
| SMILES | C=C(C)CCC1CCCc2c1oc(C1=CCCC=C1)cc2=O |
| InChI | InChI=1S/C20H24O2/c1-14(2)11-12-16-9-6-10-17-18(21)13-19(22-20(16)17)15-7-4-3-5-8-15/h4,7-8,13,16H,1,3,5-6,9-12H2,2H3 |
| InChIKey | RHOVWBIIRYLWPG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|