C17H29F2N3 — CID 130183312
4-[5-(2-aminoethyl)-3-(4,4-difluoropentyl)-3,6-dihydro-2H-pyridin-1-yl]penta-1,4-dien-2-amine (PubChem CID 130183312) has the molecular formula C17H29F2N3 and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)-3-(4,4-difluoropentyl)-3,6-dihydro-2H-pyridin-1-yl]penta-1,4-dien-2-amine.
| Compound Name | 4-[5-(2-aminoethyl)-3-(4,4-difluoropentyl)-3,6-dihydro-2H-pyridin-1-yl]penta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 130183312 |
| Molecular Formula | C17H29F2N3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 4-[5-(2-aminoethyl)-3-(4,4-difluoropentyl)-3,6-dihydro-2H-pyridin-1-yl]penta-1,4-dien-2-amine |
| SMILES | C=C(N)CC(=C)N1CC(CCN)=CC(CCCC(C)(F)F)C1 |
| InChI | InChI=1S/C17H29F2N3/c1-13(21)9-14(2)22-11-15(5-4-7-17(3,18)19)10-16(12-22)6-8-20/h10,15H,1-2,4-9,11-12,20-21H2,3H3 |
| InChIKey | JLSJWXPPUJNSOL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|