C16H20N2O3 — CID 130183324
2-[2-methyl-4-[(4Z,6Z)-6-methylocta-1,4,6-trien-2-yl]-6-oxopyrimidin-1-yl]acetic acid (PubChem CID 130183324) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[2-methyl-4-[(4Z,6Z)-6-methylocta-1,4,6-trien-2-yl]-6-oxopyrimidin-1-yl]acetic acid.
| Compound Name | 2-[2-methyl-4-[(4Z,6Z)-6-methylocta-1,4,6-trien-2-yl]-6-oxopyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 130183324 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[2-methyl-4-[(4Z,6Z)-6-methylocta-1,4,6-trien-2-yl]-6-oxopyrimidin-1-yl]acetic acid |
| SMILES | C=C(C/C=C\C(C)=C/C)c1cc(=O)n(CC(=O)O)c(C)n1 |
| InChI | InChI=1S/C16H20N2O3/c1-5-11(2)7-6-8-12(3)14-9-15(19)18(10-16(20)21)13(4)17-14/h5-7,9H,3,8,10H2,1-2,4H3,(H,20,21)/b7-6-,11-5- |
| InChIKey | WGYQAVOELCGRBX-PDDHADQFSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|