C14H26N2 — CID 130183358
N,N,N'-trimethyl-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propane-1,3-diamine (PubChem CID 130183358) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propane-1,3-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 130183358 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N,N,N'-trimethyl-N'-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]propane-1,3-diamine |
| SMILES | C=C(C)/C=C\C(=C/C)N(C)CCCN(C)C |
| InChI | InChI=1S/C14H26N2/c1-7-14(10-9-13(2)3)16(6)12-8-11-15(4)5/h7,9-10H,2,8,11-12H2,1,3-6H3/b10-9-,14-7+ |
| InChIKey | WHTAMEPKOBXYGI-YNGKKNEWSA-N |
| XLogP | 2.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|