C10H17ClS — CID 130183377
chloro-dimethyl-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-λ4-sulfane (PubChem CID 130183377) has the molecular formula C10H17ClS and a molecular weight of 204.77 g/mol. Its IUPAC name is chloro-dimethyl-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-λ4-sulfane.
| Compound Name | chloro-dimethyl-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-λ4-sulfane |
|---|---|
| PubChem CID | 130183377 |
| Molecular Formula | C10H17ClS |
| Molecular Weight | 204.77 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | chloro-dimethyl-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-λ4-sulfane |
| SMILES | C/C=C\C=C(/C=C\C)S(C)(C)Cl |
| InChI | InChI=1S/C10H17ClS/c1-5-7-9-10(8-6-2)12(3,4)11/h5-9H,1-4H3/b7-5-,8-6-,10-9+ |
| InChIKey | ISYDMCLVADRYDW-LODOGNSSSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|