About trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane
trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane (PubChem CID 130183505) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane.
Molecular Properties
| Compound Name | trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane |
| PubChem CID | 130183505 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane |
| SMILES | C[C@@H]1C=CC=C(S(C)(C)C)C1 |
| InChI | InChI=1S/C10H18S/c1-9-6-5-7-10(8-9)11(2,3)4/h5-7,9H,8H2,1-4H3/t9-/m1/s1 |
| InChIKey | ZSQXXWMWENQJJJ-SECBINFHSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane?
The IUPAC name of trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane (CID 130183505) is trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane.
What is the SMILES notation for trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane?
The canonical SMILES for trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane is C[C@@H]1C=CC=C(S(C)(C)C)C1.
What is the InChIKey of trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane?
The InChIKey is ZSQXXWMWENQJJJ-SECBINFHSA-N. The full InChI is InChI=1S/C10H18S/c1-9-6-5-7-10(8-9)11(2,3)4/h5-7,9H,8H2,1-4H3/t9-/m1/s1.
What are the key properties of trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane?
trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane has a molecular weight of 170.32 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(5S)-5-methylcyclohexa-1,3-dien-1-yl]-λ4-sulfane is sourced from PubChem (CID 130183505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).