About 3,5-dichloro-2-methyl-2,3-dihydropyridine
3,5-dichloro-2-methyl-2,3-dihydropyridine (PubChem CID 130183532) has the molecular formula C6H7Cl2N
and a molecular weight of 164.03 g/mol. Its IUPAC name is 3,5-dichloro-2-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 3,5-dichloro-2-methyl-2,3-dihydropyridine |
| PubChem CID | 130183532 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 3,5-dichloro-2-methyl-2,3-dihydropyridine |
| SMILES | CC1N=CC(Cl)=CC1Cl |
| InChI | InChI=1S/C6H7Cl2N/c1-4-6(8)2-5(7)3-9-4/h2-4,6H,1H3 |
| InChIKey | VFOZTJDIDQJITB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2-methyl-2,3-dihydropyridine?
The IUPAC name of 3,5-dichloro-2-methyl-2,3-dihydropyridine (CID 130183532) is 3,5-dichloro-2-methyl-2,3-dihydropyridine.
What is the SMILES notation for 3,5-dichloro-2-methyl-2,3-dihydropyridine?
The canonical SMILES for 3,5-dichloro-2-methyl-2,3-dihydropyridine is CC1N=CC(Cl)=CC1Cl.
What is the InChIKey of 3,5-dichloro-2-methyl-2,3-dihydropyridine?
The InChIKey is VFOZTJDIDQJITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2N/c1-4-6(8)2-5(7)3-9-4/h2-4,6H,1H3.
What are the key properties of 3,5-dichloro-2-methyl-2,3-dihydropyridine?
3,5-dichloro-2-methyl-2,3-dihydropyridine has a molecular weight of 164.03 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2-methyl-2,3-dihydropyridine is sourced from PubChem (CID 130183532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).