About (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine
(3E)-3-hydrazinylhexa-1,3,5-trien-2-amine (PubChem CID 130183716) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine.
Molecular Properties
| Compound Name | (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine |
| PubChem CID | 130183716 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C(/NN)C(=C)N |
| InChI | InChI=1S/C6H11N3/c1-3-4-6(9-8)5(2)7/h3-4,9H,1-2,7-8H2/b6-4+ |
| InChIKey | PTRXIBVQXCNRHQ-GQCTYLIASA-N |
| XLogP | -0.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine?
The IUPAC name of (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine (CID 130183716) is (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine.
What is the SMILES notation for (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine?
The canonical SMILES for (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine is C=C/C=C(/NN)C(=C)N.
What is the InChIKey of (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine?
The InChIKey is PTRXIBVQXCNRHQ-GQCTYLIASA-N. The full InChI is InChI=1S/C6H11N3/c1-3-4-6(9-8)5(2)7/h3-4,9H,1-2,7-8H2/b6-4+.
What are the key properties of (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine?
(3E)-3-hydrazinylhexa-1,3,5-trien-2-amine has a molecular weight of 125.17 g/mol, XLogP of -0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-hydrazinylhexa-1,3,5-trien-2-amine is sourced from PubChem (CID 130183716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).