About 8-methyl-7,8-dihydroquinazolin-2-amine
8-methyl-7,8-dihydroquinazolin-2-amine (PubChem CID 130184070) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 8-methyl-7,8-dihydroquinazolin-2-amine.
Molecular Properties
| Compound Name | 8-methyl-7,8-dihydroquinazolin-2-amine |
| PubChem CID | 130184070 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 8-methyl-7,8-dihydroquinazolin-2-amine |
| SMILES | CC1CC=Cc2cnc(N)nc21 |
| InChI | InChI=1S/C9H11N3/c1-6-3-2-4-7-5-11-9(10)12-8(6)7/h2,4-6H,3H2,1H3,(H2,10,11,12) |
| InChIKey | RXBIHORSTXJGNM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-7,8-dihydroquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-7,8-dihydroquinazolin-2-amine?
The IUPAC name of 8-methyl-7,8-dihydroquinazolin-2-amine (CID 130184070) is 8-methyl-7,8-dihydroquinazolin-2-amine.
What is the SMILES notation for 8-methyl-7,8-dihydroquinazolin-2-amine?
The canonical SMILES for 8-methyl-7,8-dihydroquinazolin-2-amine is CC1CC=Cc2cnc(N)nc21.
What is the InChIKey of 8-methyl-7,8-dihydroquinazolin-2-amine?
The InChIKey is RXBIHORSTXJGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6-3-2-4-7-5-11-9(10)12-8(6)7/h2,4-6H,3H2,1H3,(H2,10,11,12).
What are the key properties of 8-methyl-7,8-dihydroquinazolin-2-amine?
8-methyl-7,8-dihydroquinazolin-2-amine has a molecular weight of 161.21 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-7,8-dihydroquinazolin-2-amine is sourced from PubChem (CID 130184070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).