C17H11F6N5O2 — CID 130184471
5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(trifluoromethoxy)phenyl]-1-(2,2,2-trifluoroethanimidoyl)pyridin-2-imine (PubChem CID 130184471) has the molecular formula C17H11F6N5O2 and a molecular weight of 431.30 g/mol. Its IUPAC name is 5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(trifluoromethoxy)phenyl]-1-(2,2,2-trifluoroethanimidoyl)pyridin-2-imine.
| Compound Name | 5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(trifluoromethoxy)phenyl]-1-(2,2,2-trifluoroethanimidoyl)pyridin-2-imine |
|---|---|
| PubChem CID | 130184471 |
| Molecular Formula | C17H11F6N5O2 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 5-[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(trifluoromethoxy)phenyl]-1-(2,2,2-trifluoroethanimidoyl)pyridin-2-imine |
| SMILES | [H]/N=C(/n1cc(-c2ccc(OC(F)(F)F)c(-c3nc(C)no3)c2)cc/c1=N\[H])C(F)(F)F |
| InChI | InChI=1S/C17H11F6N5O2/c1-8-26-14(30-27-8)11-6-9(2-4-12(11)29-17(21,22)23)10-3-5-13(24)28(7-10)15(25)16(18,19)20/h2-7,24-25H,1H3/b24-13+,25-15+ |
| InChIKey | PHNSXJUHXDZYCQ-SMEUBIMOSA-N |
| XLogP | 4.28 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|