C11H19NO3 — CID 130184633
[(2R,4S)-1-(2,2-dimethylpropanoyl)-4-methylpyrrolidin-2-yl] formate (PubChem CID 130184633) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is [(2R,4S)-1-(2,2-dimethylpropanoyl)-4-methylpyrrolidin-2-yl] formate.
| Compound Name | [(2R,4S)-1-(2,2-dimethylpropanoyl)-4-methylpyrrolidin-2-yl] formate |
|---|---|
| PubChem CID | 130184633 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | [(2R,4S)-1-(2,2-dimethylpropanoyl)-4-methylpyrrolidin-2-yl] formate |
| SMILES | C[C@H]1C[C@@H](OC=O)N(C(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C11H19NO3/c1-8-5-9(15-7-13)12(6-8)10(14)11(2,3)4/h7-9H,5-6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | MWVYTLNCCPVOFZ-DTWKUNHWSA-N |
| XLogP | 1.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|