C21H32N2O4S — CID 130185002
(2R,3R)-3-amino-2-hydroxy-4-propylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanoic acid (PubChem CID 130185002) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-hydroxy-4-propylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanoic acid.
| Compound Name | (2R,3R)-3-amino-2-hydroxy-4-propylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 130185002 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2R,3R)-3-amino-2-hydroxy-4-propylsulfanyl-2-[(4-spiro[2.5]octan-6-yloxy-2-pyridinyl)methyl]butanoic acid |
| SMILES | CCCSC[C@H](N)[C@](O)(Cc1cc(OC2CCC3(CC2)CC3)ccn1)C(=O)O |
| InChI | InChI=1S/C21H32N2O4S/c1-2-11-28-14-18(22)21(26,19(24)25)13-15-12-17(5-10-23-15)27-16-3-6-20(7-4-16)8-9-20/h5,10,12,16,18,26H,2-4,6-9,11,13-14,22H2,1H3,(H,24,25)/t18-,21+/m0/s1 |
| InChIKey | VAUXSIIFLVHDCQ-GHTZIAJQSA-N |
| XLogP | 3.01 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|