C20H32N2O4S — CID 130185024
(2R,3R)-3-amino-2-hydroxy-2-[[4-(4-methylcyclohexyl)oxy-2-pyridinyl]methyl]-4-propylsulfanylbutanoic acid (PubChem CID 130185024) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is (2R,3R)-3-amino-2-hydroxy-2-[[4-(4-methylcyclohexyl)oxy-2-pyridinyl]methyl]-4-propylsulfanylbutanoic acid.
| Compound Name | (2R,3R)-3-amino-2-hydroxy-2-[[4-(4-methylcyclohexyl)oxy-2-pyridinyl]methyl]-4-propylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 130185024 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (2R,3R)-3-amino-2-hydroxy-2-[[4-(4-methylcyclohexyl)oxy-2-pyridinyl]methyl]-4-propylsulfanylbutanoic acid |
| SMILES | CCCSC[C@H](N)[C@](O)(Cc1cc(OC2CCC(C)CC2)ccn1)C(=O)O |
| InChI | InChI=1S/C20H32N2O4S/c1-3-10-27-13-18(21)20(25,19(23)24)12-15-11-17(8-9-22-15)26-16-6-4-14(2)5-7-16/h8-9,11,14,16,18,25H,3-7,10,12-13,21H2,1-2H3,(H,23,24)/t14?,16?,18-,20+/m0/s1 |
| InChIKey | IHAGYUSLRGLLCB-GGXSUZLTSA-N |
| XLogP | 2.87 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|