About thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate
thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate (PubChem CID 130185150) has the molecular formula C11H12ClN2O2PS
and a molecular weight of 302.72 g/mol. Its IUPAC name is thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate |
| PubChem CID | 130185150 |
| Molecular Formula | C11H12ClN2O2PS |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate |
| SMILES | O=C(OP=S)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C11H12ClN2O2PS/c12-9-3-1-2-4-10(9)13-5-7-14(8-6-13)11(15)16-17-18/h1-4H,5-8H2 |
| InChIKey | BCZRXYKSLZNRIA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate?
The IUPAC name of thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate (CID 130185150) is thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate.
What is the SMILES notation for thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate?
The canonical SMILES for thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate is O=C(OP=S)N1CCN(c2ccccc2Cl)CC1.
What is the InChIKey of thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate?
The InChIKey is BCZRXYKSLZNRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN2O2PS/c12-9-3-1-2-4-10(9)13-5-7-14(8-6-13)11(15)16-17-18/h1-4H,5-8H2.
What are the key properties of thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate?
thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate has a molecular weight of 302.72 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophosphoroso 4-(2-chlorophenyl)piperazine-1-carboxylate is sourced from PubChem (CID 130185150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).