C21H23F2NO8P+ — CID 130187470
1-[1-[(2R,3S,5R)-5-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-yl]ethanone (PubChem CID 130187470) has the molecular formula C21H23F2NO8P+ and a molecular weight of 486.38 g/mol. Its IUPAC name is 1-[1-[(2R,3S,5R)-5-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-yl]ethanone.
| Compound Name | 1-[1-[(2R,3S,5R)-5-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-yl]ethanone |
|---|---|
| PubChem CID | 130187470 |
| Molecular Formula | C21H23F2NO8P+ |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-[1-[(2R,3S,5R)-5-[[(4S)-4-(3,5-difluorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-yl]ethanone |
| SMILES | CC(=O)c1ccc[n+]([C@@H]2O[C@H](COP3(=O)OCC[C@@H](c4cc(F)cc(F)c4)O3)C(O)[C@@H]2O)c1 |
| InChI | InChI=1S/C21H23F2NO8P/c1-12(25)13-3-2-5-24(10-13)21-20(27)19(26)18(31-21)11-30-33(28)29-6-4-17(32-33)14-7-15(22)9-16(23)8-14/h2-3,5,7-10,17-21,26-27H,4,6,11H2,1H3/q+1/t17-,18+,19?,20-,21+,33?/m0/s1 |
| InChIKey | ODHCPZUUIYVBGR-SPQGRDNFSA-N |
| XLogP | 2.38 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|