C9H10Cl3NS — CID 13018774
3-(2,4,5-trichlorophenyl)sulfanylpropan-1-amine (PubChem CID 13018774) has the molecular formula C9H10Cl3NS and a molecular weight of 270.61 g/mol. Its IUPAC name is 3-(2,4,5-trichlorophenyl)sulfanylpropan-1-amine.
| Compound Name | 3-(2,4,5-trichlorophenyl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 13018774 |
| Molecular Formula | C9H10Cl3NS |
| Molecular Weight | 270.61 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 3-(2,4,5-trichlorophenyl)sulfanylpropan-1-amine |
| SMILES | NCCCSc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3NS/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,1-3,13H2 |
| InChIKey | HOZQUYAQPZAAFJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|