C21H24O6S2 — CID 130187915
[(6R,8S,8aR)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate (PubChem CID 130187915) has the molecular formula C21H24O6S2 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(6R,8S,8aR)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate.
| Compound Name | [(6R,8S,8aR)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 130187915 |
| Molecular Formula | C21H24O6S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | [(6R,8S,8aR)-8-methyl-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
| SMILES | C[C@@H]1C(OS(C)(=O)=O)[C@@H](Sc2ccccc2)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C21H24O6S2/c1-14-18-17(13-24-20(26-18)15-9-5-3-6-10-15)25-21(19(14)27-29(2,22)23)28-16-11-7-4-8-12-16/h3-12,14,17-21H,13H2,1-2H3/t14-,17?,18+,19?,20?,21+/m0/s1 |
| InChIKey | RAIXBUXHNLCTIF-GSSGAUFRSA-N |
| XLogP | 3.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|