C25H35N5O3 — CID 130188022
5-cyclopropyl-N-[[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-piperidin-4-ylmethyl]-1,2-oxazole-3-carboxamide (PubChem CID 130188022) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 5-cyclopropyl-N-[[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-piperidin-4-ylmethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-piperidin-4-ylmethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 130188022 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 5-cyclopropyl-N-[[3-[3-(dimethylamino)propylcarbamoyl]phenyl]-piperidin-4-ylmethyl]-1,2-oxazole-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(C(NC(=O)c2cc(C3CC3)on2)C2CCNCC2)c1 |
| InChI | InChI=1S/C25H35N5O3/c1-30(2)14-4-11-27-24(31)20-6-3-5-19(15-20)23(18-9-12-26-13-10-18)28-25(32)21-16-22(33-29-21)17-7-8-17/h3,5-6,15-18,23,26H,4,7-14H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | OXQAGQVLBKDBDP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|