About 4-hydroxybenzonitrile
4-hydroxybenzonitrile (PubChem CID 13019) has the molecular formula C7H5NO
and a molecular weight of 119.12 g/mol. Its IUPAC name is 4-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 4-hydroxybenzonitrile |
| PubChem CID | 13019 |
| Molecular Formula | C7H5NO |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | 4-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H |
| InChIKey | CVNOWLNNPYYEOH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzonitrile?
The IUPAC name of 4-hydroxybenzonitrile (CID 13019) is 4-hydroxybenzonitrile.
What is the SMILES notation for 4-hydroxybenzonitrile?
The canonical SMILES for 4-hydroxybenzonitrile is N#Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzonitrile?
The InChIKey is CVNOWLNNPYYEOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H.
What are the key properties of 4-hydroxybenzonitrile?
4-hydroxybenzonitrile has a molecular weight of 119.12 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzonitrile is sourced from PubChem (CID 13019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).