C7H6Cl2N4 — CID 13019083
7-chloro-2-(chloromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 13019083) has the molecular formula C7H6Cl2N4 and a molecular weight of 217.06 g/mol. Its IUPAC name is 7-chloro-2-(chloromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-2-(chloromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 13019083 |
| Molecular Formula | C7H6Cl2N4 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 7-chloro-2-(chloromethyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(Cl)n2nc(CCl)nc2n1 |
| InChI | InChI=1S/C7H6Cl2N4/c1-4-2-5(9)13-7(10-4)11-6(3-8)12-13/h2H,3H2,1H3 |
| InChIKey | ZVOYKKFXDAPPRX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|