C27H25N5 — CID 130191834
4-[3-methyl-15-[(3R)-3-methylpyrrolidin-1-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,7,9,14,16-heptaen-9-yl]benzonitrile (PubChem CID 130191834) has the molecular formula C27H25N5 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[3-methyl-15-[(3R)-3-methylpyrrolidin-1-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,7,9,14,16-heptaen-9-yl]benzonitrile.
| Compound Name | 4-[3-methyl-15-[(3R)-3-methylpyrrolidin-1-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,7,9,14,16-heptaen-9-yl]benzonitrile |
|---|---|
| PubChem CID | 130191834 |
| Molecular Formula | C27H25N5 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[3-methyl-15-[(3R)-3-methylpyrrolidin-1-yl]-2,5,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(13),3,5,7,9,14,16-heptaen-9-yl]benzonitrile |
| SMILES | Cc1cnc2n1-c1ccc(N3CC[C@@H](C)C3)cc1Cn1cc(-c3ccc(C#N)cc3)cc1-2 |
| InChI | InChI=1S/C27H25N5/c1-18-9-10-30(15-18)24-7-8-25-23(11-24)17-31-16-22(21-5-3-20(13-28)4-6-21)12-26(31)27-29-14-19(2)32(25)27/h3-8,11-12,14,16,18H,9-10,15,17H2,1-2H3/t18-/m1/s1 |
| InChIKey | AOMRWTUZLXCYBG-GOSISDBHSA-N |
| XLogP | 5.40 |
| TPSA | 49.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|