About (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid
(4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid (PubChem CID 130192161) has the molecular formula C6H7NO5
and a molecular weight of 173.12 g/mol. Its IUPAC name is (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| PubChem CID | 130192161 |
| Molecular Formula | C6H7NO5 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| SMILES | CC(=O)N1C(=O)OC[C@H]1C(=O)O |
| InChI | InChI=1S/C6H7NO5/c1-3(8)7-4(5(9)10)2-12-6(7)11/h4H,2H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | QOPOYTPWONIUOS-BYPYZUCNSA-N |
| XLogP | -0.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid?
The IUPAC name of (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid (CID 130192161) is (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid.
What is the SMILES notation for (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid?
The canonical SMILES for (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid is CC(=O)N1C(=O)OC[C@H]1C(=O)O.
What is the InChIKey of (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid?
The InChIKey is QOPOYTPWONIUOS-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H7NO5/c1-3(8)7-4(5(9)10)2-12-6(7)11/h4H,2H2,1H3,(H,9,10)/t4-/m0/s1.
What are the key properties of (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid?
(4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid has a molecular weight of 173.12 g/mol, XLogP of -0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-acetyl-2-oxo-1,3-oxazolidine-4-carboxylic acid is sourced from PubChem (CID 130192161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).