C27H38FNO4 — CID 130192317
(2S)-2-[[4-[3-(3-bicyclo[3.3.1]nonanyl)propoxy]-5-cyclopropyl-2-fluorobenzoyl]amino]-3-methylbutanoic acid (PubChem CID 130192317) has the molecular formula C27H38FNO4 and a molecular weight of 459.60 g/mol. Its IUPAC name is (2S)-2-[[4-[3-(3-bicyclo[3.3.1]nonanyl)propoxy]-5-cyclopropyl-2-fluorobenzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[3-(3-bicyclo[3.3.1]nonanyl)propoxy]-5-cyclopropyl-2-fluorobenzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 130192317 |
| Molecular Formula | C27H38FNO4 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | (2S)-2-[[4-[3-(3-bicyclo[3.3.1]nonanyl)propoxy]-5-cyclopropyl-2-fluorobenzoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1cc(C2CC2)c(OCCCC2CC3CCCC(C2)C3)cc1F)C(=O)O |
| InChI | InChI=1S/C27H38FNO4/c1-16(2)25(27(31)32)29-26(30)22-14-21(20-8-9-20)24(15-23(22)28)33-10-4-7-19-12-17-5-3-6-18(11-17)13-19/h14-20,25H,3-13H2,1-2H3,(H,29,30)(H,31,32)/t17?,18?,19?,25-/m0/s1 |
| InChIKey | ITBIXBQVIACLFN-BWHLHEOVSA-N |
| XLogP | 5.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|