C14H16O4 — CID 130192696
[(2E,4Z)-4-[(Z)-1-ethenylprop-1-enyl]-5-formyloxyhepta-2,4,6-trien-3-yl] formate (PubChem CID 130192696) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(2E,4Z)-4-[(Z)-1-ethenylprop-1-enyl]-5-formyloxyhepta-2,4,6-trien-3-yl] formate.
| Compound Name | [(2E,4Z)-4-[(Z)-1-ethenylprop-1-enyl]-5-formyloxyhepta-2,4,6-trien-3-yl] formate |
|---|---|
| PubChem CID | 130192696 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [(2E,4Z)-4-[(Z)-1-ethenylprop-1-enyl]-5-formyloxyhepta-2,4,6-trien-3-yl] formate |
| SMILES | C=CC(=C/C)/C(=C(\C=C)OC=O)C(=C\C)/OC=O |
| InChI | InChI=1S/C14H16O4/c1-5-11(6-2)14(12(7-3)17-9-15)13(8-4)18-10-16/h5-10H,1,3H2,2,4H3/b11-6-,13-8+,14-12- |
| InChIKey | LDDJAUJXORZAAW-RTFXQIBTSA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|